AC1MIOOG
(2R)-2-[[(1R)-2-(dimethylamino)-1-phenylethyl]disulfanyl]-N,N-dimethyl-2-phenylethanamine;dihydrochloride
Also Known As: Benzeneethanamine, beta,beta'-dithiobis(N,N-dimethyl-, dihydrochloride, (R-(R*,R*))-|(R-(R*,R*))-beta,beta'-Dithiobis(N,N-dimethylbenzeneethanamine) dihydrochloride|Benzeneethanamine, beta,beta'-dithiobis(N,N-dimethyl-, dihydrochloride, DL-|(2R)-2-[[(1R)-2-(dimethylamino)-1-phenylethyl]disulfanyl]-N,N-dimethyl-2-phenylethanamine dihydrochloride|(2R,2'R)-2,2'-Disulfanediylbis(N,N-dimethyl-2-phenylethan-1-amine)--hydrogen chloride (1/2)
| Molecular Formula | C20H30Cl2N2S2 |
|---|---|
| Molecular Weight | 432.12274 g/mol |
| LogP | 5.8172 |
| Topological Polar Surface Area | 6.48 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Exact Mass | 432.12274 |
| Monoisotopic Mass | 432.12274 |
| Heavy Atoms | 26 |
| Complexity | 529.37976 |
Chemical Identifiers
| CAS Number | 65376-33-2 |
|---|---|
| SMILES | CN(C)C[C@@H](C1=CC=CC=C1)SS[C@@H](CN(C)C)C2=CC=CC=C2.Cl.Cl |
Product Overview
AC1MIOOG (CAS 65376-33-2), with molecular formula C20H30Cl2N2S2 and molecular weight 432.12274 g/mol. IUPAC: (2R)-2-[[(1R)-2-(dimethylamino)-1-phenylethyl]disulfanyl]-N,N-dimethyl-2-phenylethanamine;dihydrochloride.