1,1'-[(7-Nitro-9h-fluoren-2-yl)imino]dipropan-2-ol
1-[2-hydroxypropyl-(7-nitro-9H-fluoren-2-yl)amino]propan-2-ol
Also Known As: KST-1B8223|1,1'-[(7-nitro-9h-fluoren-2-yl)imino]dipropan-2-ol|1-[2-hydroxypropyl-(7-nitro-9H-fluoren-2-yl)amino]propan-2-ol|1,1'-((7-Nitro-9H-fluoren-2-yl)azanediyl)bis(propan-2-ol)|1,1'-[(7-Nitro-9H-fluoren-2-yl)azanediyl]di(propan-2-ol)|1-[2-hydroxypropyl-(7-nitro-9H-fluoren-2-yl)amino]propan-2-o|1-[(7-nitro-9H-fluoren-2-yl)-(2-oxidanylpropyl)amino]propan-2-ol|1-[2-hydroxypropyl-(7-nitro-9H-fluoren-2-yl)amino]-2-propanol
| Molecular Formula | C19H22N2O4 |
|---|---|
| Molecular Weight | 342.15796 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 89.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 342.15796 |
| Monoisotopic Mass | 342.15796 |
| Heavy Atoms | 25 |
| Complexity | 459.0 |
Chemical Identifiers
| CAS Number | 6583-93-3 |
|---|---|
| SMILES | CC(CN(CC(C)O)C1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)[N+](=O)[O-])O |
| InChIKey | MTICILMIBQZPDG-UHFFFAOYSA-N |
Product Overview
1,1'-[(7-Nitro-9h-fluoren-2-yl)imino]dipropan-2-ol (CAS 6583-93-3), with molecular formula C19H22N2O4 and molecular weight 342.15796 g/mol. IUPAC: 1-[2-hydroxypropyl-(7-nitro-9H-fluoren-2-yl)amino]propan-2-ol.
1,1'-[(7-Nitro-9h-fluoren-2-yl)imino]dipropan-2-ol is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »