2,6-Bis(trifluoromethyl)benzoyl chloride
2,6-bis(trifluoromethyl)benzoyl chloride
Also Known As: 2,6-bis(trifluoromethyl)benzoyl chloride|Methyl 2-cyanobenzoate|ACMC-1AOXM|2,6-BIS BENZOYLCHLORIDE|PC3103L|JRD-0356|FS-4107|2,6-Bis-trifluoromethylbenzoyl chloride|2,6-Bis-trifluoromethyl-benzoyl chloride|2,6-Bis(trifluoromethyl)benzoylchloride98%|Benzoylchloride, 2,6-bis(trifluoromethyl)-|Benzoyl chloride, 2,6-bis(trifluoromethyl)-|2,6-Bis(trifluoromethyl)benzoyl chloride, 97%|2,6-BIS(TRIFLUOROMETHYL)BENZOYLCHLORIDE|2,6 - Bis - trifluoromethyl - benzoyl chloride|3-(3,5-dimethyl-1H-pyrazol-1-yl)propan-1-amine|I01-14703
| Molecular Formula | C9H3ClF6O |
|---|---|
| Molecular Weight | 275.97766 g/mol |
| LogP | 4.1032 |
| Topological Polar Surface Area | 17.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 275.97766 |
| Monoisotopic Mass | 275.97766 |
| Heavy Atoms | 17 |
| Complexity | 415.5298 |
Chemical Identifiers
| CAS Number | 6587-24-2 |
|---|---|
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)C(=O)Cl)C(F)(F)F |
Product Overview
2,6-Bis(trifluoromethyl)benzoyl chloride (CAS 6587-24-2), with molecular formula C9H3ClF6O and molecular weight 275.97766 g/mol. IUPAC: 2,6-bis(trifluoromethyl)benzoyl chloride.