Danshenxinkun B
1-hydroxy-8-methyl-2-propan-2-ylphenanthrene-3,4-dione
Also Known As: Danshenxinkun B|Danshexinkun B|Tanshiquinone B|HY-N6922|NP4439|TN1551|1-hydroxy-8-methyl-2-propan-2-ylphenanthrene-3,4-dione|3-Hydroxy-2-isopropyl-8-methyl-1,4-phenanthrenedione|Tanshinone Impurity 4; Danshenxinkun B|3-Hydroxy-2-isopropyl-8-methylphenanthrene-1,4-dione|1-Hydroxy-8-methyl-2-(propan-2-yl)phenanthrene-3,4-dione|3-hydroxy-8-methyl-2-(propan-2-yl)-1,4-dihydrophenanthrene-1,4-dione|N/A
| Molecular Formula | C18H16O3 |
|---|---|
| Molecular Weight | 280.10995 g/mol |
| LogP | 3.83872 |
| Topological Polar Surface Area | 54.37 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 280.10995 |
| Monoisotopic Mass | 280.10995 |
| Heavy Atoms | 21 |
| Complexity | 825.71747 |
Chemical Identifiers
| CAS Number | 65907-76-8 |
|---|---|
| SMILES | CC1=C2C=CC3=C(C2=CC=C1)C(=O)C(=O)C(=C3O)C(C)C |
Product Overview
Danshenxinkun B (CAS 65907-76-8), with molecular formula C18H16O3 and molecular weight 280.10995 g/mol. IUPAC: 1-hydroxy-8-methyl-2-propan-2-ylphenanthrene-3,4-dione.
Danshenxinkun B is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »