Caulibugulone B
TL;DR: Caulibugulone B (CAS 662167-16-0) is a chemical compound with molecular formula C10H7BrN2O2 and molecular weight 265.9691 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
Caulibugulone B
6-bromo-7-(methylamino)isoquinoline-5,8-dione
Also Known As: Caulibugulone B, UPCMLD00WCaulibugB, 6-bromo-7-(methylamino)isoquinoline-5,8-dione, YZQJGPPACTZUKY-UHFFFAOYSA-, CMLD4_000048
Technical Specifications
| Molecular Formula | C10H7BrN2O2 |
| Molecular Weight | 265.9691 g/mol |
| XLogP | 1.5 |
| Topological Polar Surface Area (TPSA) | 59.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 265.9691 Da |
| Heavy Atoms | 15 |
| Complexity | 351.0 |
| SMILES | CNC1=C(C(=O)C2=C(C1=O)C=NC=C2)Br |
| InChIKey | YZQJGPPACTZUKY-UHFFFAOYSA-N |
Chemical Property Profile of Caulibugulone B
Property Insights of Caulibugulone B
The XLogP value of 1.5 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Caulibugulone B. With a topological polar surface area (TPSA) of 59.1 Ų, Caulibugulone B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Caulibugulone B has 1 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of Caulibugulone B?
The CAS number of Caulibugulone B is 662167-16-0.
What is the molecular formula of Caulibugulone B?
The molecular formula of Caulibugulone B is C10H7BrN2O2.
What is the molecular weight of Caulibugulone B?
The molecular weight of Caulibugulone B is 265.9691 g/mol.
Where can I buy Caulibugulone B?
You can request a quote for Caulibugulone B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Caulibugulone B?
Yes, CoreyChem provides custom synthesis services for Caulibugulone B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.