N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide
N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide
Also Known As: Kecaoan|Monsanto 31675|s219|N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide|2-tert-Butyl-6-methylchloroacetanilide|CP 31675|NCI60_006225|o-Acetotoluidide, 6'-tert-butyl-2-chloro-|2-Chloro-N-(2-methyl-6-tert-butylphenyl)acetamide|2-CHLORO-N-(2-TERT-BUTYL-6-METHYLPHENYL)ACETAMIDE|Acetamide, 2-chloro-N-(2-(1,1-dimethylethyl)-6-methylphenyl)- (9CI)|Acetamide, 2-chloro-N-[2-(1,1-dimethylethyl)-6-methylphenyl]-
| Molecular Formula | C13H18ClNO |
|---|---|
| Molecular Weight | 239.1077 g/mol |
| LogP | 3.8 |
| Topological Polar Surface Area | 29.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 239.1077 |
| Monoisotopic Mass | 239.1077 |
| Heavy Atoms | 16 |
| Complexity | 247.0 |
Chemical Identifiers
| CAS Number | 6641-63-0 |
|---|---|
| SMILES | CC1=C(C(=CC=C1)C(C)(C)C)NC(=O)CCl |
| InChIKey | JYNOTRFRRIKTHZ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide (CAS 6641-63-0), with molecular formula C13H18ClNO and molecular weight 239.1077 g/mol. IUPAC: N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide.