(3-Aminophenyl)boronic acid sulfate
(3-aminophenyl)boronic acid;sulfuric acid
Also Known As: (3-aminophenyl)boronic acid sulfate|M-APBA|3-Aminophenylboronic acid|(3-aminophenyl)boronic acid;sulfuric acid|Boronic acid, (3-aminophenyl)-, homopolymer|Sulfuric acid compound with (3-aminophenyl)boronic acid (1:1)|Boronic acid, (3-aminophenyl)-, sulfate|3-Aminobenzeneboronic acid hemisulfate salt|Benzeneboronic acid, m-amino-,hydrogen sulfate|(3-aminophenyl)boronic acid; sulfuric acid|M-AMINOPHENYLBORONIC ACID HEMISULFATE|M-AMINOPHENYLBORONIC ACID; SULFURIC ACID|3-aminophenylboronic acid hydrogen sulphate salt|BORONICACID, B-(3-AMINOPHENYL)-, HOMOPOLYMER|(3-Aminophenyl)boronic acid--sulfuric acid (1/1)|Boronic acid, B-(3-aminophenyl)-, sulfate (1:1)
| Molecular Formula | C6H10BNO6S |
|---|---|
| Molecular Weight | 235.03218 g/mol |
| LogP | -1.7042 |
| Topological Polar Surface Area | 149.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Exact Mass | 235.03218 |
| Monoisotopic Mass | 235.03218 |
| Heavy Atoms | 15 |
| Complexity | 191.0 |
Chemical Identifiers
| CAS Number | 66472-86-4 |
|---|---|
| SMILES | B(C1=CC(=CC=C1)N)(O)O.OS(=O)(=O)O |
| InChIKey | XMVGYYBQCXVVHU-UHFFFAOYSA-N |
Product Overview
(3-Aminophenyl)boronic acid sulfate (CAS 66472-86-4), with molecular formula C6H10BNO6S and molecular weight 235.03218 g/mol. IUPAC: (3-aminophenyl)boronic acid;sulfuric acid.
(3-Aminophenyl)boronic acid sulfate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »