Acetone-D6
1,1,1,3,3,3-hexadeuteriopropan-2-one
Also Known As: Acetone-d6|Acetone d6|Hexadeuteroacetone|(2H6)Acetone|Perdeuteroacetone|acetone|Acetone-d|d6-acetone|hexadeuterioacetone|Chevron acetone|aceton-d6|deuterated acetone|d-6 acetone|Acetone, perdeutero-|[D6]acetone|Acetone-[D?]|PERDEUTERIOACETONE|Propan-2-on-D6|(2H6)Propan-2-one|(2H6)Aceton|2-PROPANONE-D6|((2)H6)propan-2-one|(2H6)-2-Propanone|(2H6)Propane-2-one|(CD3)2CO|e(R) u+/-uI feminine|ACETONE-D6 2EACH|Di[(2H3)methyl] ketone|ACETONE-D6 10G|Bis[(2H3)methyl] ketone|Acetone D6 >99.8%|ACETONE-D6 10EACH|Hexadeuteroacetone 99.9%D|Acetone-d6 (reagent grade)|ACETONE-D6 5X10G|Acetone D6 >99.96%|1,1,1,3,3,3-hexadeuteriopropan-2-one|EINECS 211-563-9|(~2~H_6_)Propan-2-one
| Molecular Formula | C3H6O |
|---|---|
| Molecular Weight | 64.07953 g/mol |
| LogP | -0.1 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 64.07953 |
| Monoisotopic Mass | 64.07953 |
| Heavy Atoms | 4 |
| Complexity | 26.0 |
Chemical Identifiers
| CAS Number | 666-52-4 |
|---|---|
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] |
| InChIKey | CSCPPACGZOOCGX-WFGJKAKNSA-N |
Patent-Derived Application Labels
Derived from 18 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Acetone-D6 (CAS 666-52-4), with molecular formula C3H6O and molecular weight 64.07953 g/mol. IUPAC: 1,1,1,3,3,3-hexadeuteriopropan-2-one.