(E)-3-(3-Methoxyphenyl)-2-methylacrylic acid
(E)-3-(3-methoxyphenyl)-2-methylprop-2-enoic acid
Also Known As: (E)-3-(3-Methoxyphenyl)-2-methylacrylic acid|alpha-Methyl-3-methoxycinnamic acid|(2E)-3-(3-methoxyphenyl)-2-methylprop-2-enoic acid|(E)-3-(3-methoxyphenyl)-2-methylprop-2-enoic acid|3-(3-methoxyphenyl)-2-methylacrylic acid|(E)-3-(3-Methoxyphenyl)-2-methylacrylicacid|J2.617.645J|3-(3-Methoxyphenyl)-2-methyl-2-Propenoicacid|W-3817|2-Propenoic acid, 3-(3-methoxyphenyl)-2-methyl-, (2E)-|2-Propenoic acid, 3-(3-methoxyphenyl)-2-methyl-|3-(3-methoxyphenyl)-2-methyl-prop-2-enoic Acid|(E)-3-(3-Methoxyphenyl)-2-methyl-2-propenoic acid
| Molecular Formula | C11H12O3 |
|---|---|
| Molecular Weight | 192.07864 g/mol |
| LogP | 2.1831 |
| Topological Polar Surface Area | 46.53 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 192.07864 |
| Monoisotopic Mass | 192.07864 |
| Heavy Atoms | 14 |
| Complexity | 366.55032 |
Chemical Identifiers
| CAS Number | 66735-17-9 |
|---|---|
| SMILES | C/C(=C\C1=CC(=CC=C1)OC)/C(=O)O |
Product Overview
(E)-3-(3-Methoxyphenyl)-2-methylacrylic acid (CAS 66735-17-9), with molecular formula C11H12O3 and molecular weight 192.07864 g/mol. IUPAC: (E)-3-(3-methoxyphenyl)-2-methylprop-2-enoic acid.