![2-[(4-Chlorophenyl)thio]-5-nitrobenzoic acid structure](/static/products/6694/66949-29-9.webp)
2-[(4-Chlorophenyl)thio]-5-nitrobenzoic acid
2-(4-chlorophenyl)sulfanyl-5-nitrobenzoic acid
Also Known As: 2-[(4-chlorophenyl)thio]-5-nitrobenzoic acid|Oprea1_843618|2-[(4-chlorophenyl)sulfanyl]-5-nitrobenzoic acid|2-((4-Chlorophenyl)thio)-5-nitrobenzoic acid|2-(4-chlorophenyl)sulfanyl-5-nitrobenzoic acid|2-(4-chlorophenylthio)-5-nitrobenzoic acid|2-((4-Chlorophenyl)thio)-5-nitrobenzoicacid|2-(4-chlorophenyl)sulfanyl-5-nitro-benzoic acid|2-(4-Chloro-phenylsulfanyl)-5-nitro-benzoic acid|AE-641/30103045|A2654/0113101|SR-01000535157-1|2-[(4-CHLOROPHENYL)THIO]-5-NITROBENZOICACID
| Molecular Formula | C13H8ClNO4S |
|---|---|
| Molecular Weight | 308.98627 g/mol |
| LogP | 4.1 |
| Topological Polar Surface Area | 108.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 308.98627 |
| Monoisotopic Mass | 308.98627 |
| Heavy Atoms | 20 |
| Complexity | 368.0 |
Chemical Identifiers
| CAS Number | 66949-29-9 |
|---|---|
| SMILES | C1=CC(=CC=C1SC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O)Cl |
| InChIKey | BVVJQOLVSLSVQN-UHFFFAOYSA-N |
Product Overview
2-[(4-Chlorophenyl)thio]-5-nitrobenzoic acid (CAS 66949-29-9), with molecular formula C13H8ClNO4S and molecular weight 308.98627 g/mol. IUPAC: 2-(4-chlorophenyl)sulfanyl-5-nitrobenzoic acid.
2-[(4-Chlorophenyl)thio]-5-nitrobenzoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »