Ethyl 2-(ethoxymethylene)acetoacetate
ethyl (2E)-2-(ethoxymethylidene)-3-oxobutanoate
Also Known As: Ethyl 2-(ethoxymethylene)acetoacetate|ethyl 2-(ethoxymethylene)-3-oxobutanoate|ETHYL2- ACETOACETATE|Ethyl 2-Acetyl-3-ethoxyacrylate|EINECS 223-259-3|(E)-ethyl 2-(ethoxymethylene)-3-oxobutanoate|2-(Ethoxymethylene)-3-oxobutanoic acid ethyl ester|CS-M2053|2-Acetyl-3-ethoxyacrylic Acid Ethyl Ester|DS-1355|ethyl 2-(ethoxymethylidene)-3-oxobutanoate|ethyl (2E)-2-(ethoxymethylidene)-3-oxobutanoate|Ethyl 2-(ethoxymethylene)-3-oxobutyrate|ethyl (E)-2-(ethoxymethylene)-3-oxobutanoate|2-ethoxymethylene-3-oxobutanoic acid ethyl ester|Ethyl (2E)-2-(ethoxymethylene)-3-oxobutanoate|Ethyl trans-2-(ethoxymethylene)acetoacetate|(E)-ethyl2-(ethoxymethylene)-3-oxobutanoate|4CH-009916
| Molecular Formula | C9H14O4 |
|---|---|
| Molecular Weight | 186.0892 g/mol |
| LogP | 1.0589 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 186.0892 |
| Monoisotopic Mass | 186.0892 |
| Heavy Atoms | 13 |
| Complexity | 217.65459 |
Chemical Identifiers
| CAS Number | 66975-53-9 |
|---|---|
| SMILES | CCO/C=C(\C(=O)C)/C(=O)OCC |
Product Overview
Ethyl 2-(ethoxymethylene)acetoacetate (CAS 66975-53-9), with molecular formula C9H14O4 and molecular weight 186.0892 g/mol. IUPAC: ethyl (2E)-2-(ethoxymethylidene)-3-oxobutanoate.