(4-Methylpiperazin-1-yl)(2-nitrophenyl)methanone
(4-methylpiperazin-1-yl)-(2-nitrophenyl)methanone
Also Known As: (4-methylpiperazin-1-yl)(2-nitrophenyl)methanone|Oprea1_125644|Oprea1_162782|CBDivE_014126|0292AC|BAS 00622821|1-METHYL-4-(2-NITROBENZOYL)PIPERAZINE|4-methylpiperazinyl 2-nitrophenyl ketone|(4-methylpiperazin-1-yl)-(2-nitrophenyl)methanone|Piperazine, 1-methyl-4-(2-nitrobenzoyl)-|(4-Methyl-piperazin-1-yl)-(2-nitro-phenyl)-methanone|AB00079037-01|piperazine, 1-methyl-4-(2-nitrobenzoyl)-, hydrochloride|(4-METHYLPIPERAZINO)(2-NITROPHENYL)METHANONE|1-methyl-4-(2-nitrobenzoyl)piperazine hydrochloride
| Molecular Formula | C12H15N3O3 |
|---|---|
| Molecular Weight | 249.11134 g/mol |
| LogP | 0.1 |
| Topological Polar Surface Area | 69.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 249.11134 |
| Monoisotopic Mass | 249.11134 |
| Heavy Atoms | 18 |
| Complexity | 321.0 |
Chemical Identifiers
| CAS Number | 67023-01-2 |
|---|---|
| SMILES | CN1CCN(CC1)C(=O)C2=CC=CC=C2[N+](=O)[O-] |
| InChIKey | YRQBFQMVTVLQGD-UHFFFAOYSA-N |
Product Overview
(4-Methylpiperazin-1-yl)(2-nitrophenyl)methanone (CAS 67023-01-2), with molecular formula C12H15N3O3 and molecular weight 249.11134 g/mol. IUPAC: (4-methylpiperazin-1-yl)-(2-nitrophenyl)methanone.