2,4-Diazaspiro(5.5)undec-8-ene-1,3,5-trione, 11-methyl-3-thioxo-
11-methyl-3-sulfanylidene-2,4-diazaspiro[5.5]undec-8-ene-1,5-dione
Also Known As: 2,5-dione, 11-methyl-3-thioxo-|4-24-00-02041 (Beilstein Handbook Reference)|2,4-Diazaspiro(5.5)undec-8-ene-1,3,5-trione, 11-methyl-3-thioxo-|11-Methyl-3-thioxo-2,4-diazaspiro(5.5)undec-8-ene-1,3,5-trione|2,4-Diazaspiro[5.5]undec-8-ene-1,5-dione, 11-methyl-3-thioxo-|11-Methyl-3-thioxo-2,4-diazaspiro[5.5]undec-8-ene-1,5-dione|11-methyl-3-sulfanylidene-2,4-diazaspiro[5.5]undec-8-ene-1,5-dione|5-methyl-9-sulfanylidene-8,10-diazaspiro[5.5]undec-2-ene-7,11-dione
| Molecular Formula | C10H12N2O2S |
|---|---|
| Molecular Weight | 224.06195 g/mol |
| LogP | 0.4898 |
| Topological Polar Surface Area | 58.2 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 0 |
| Exact Mass | 224.06195 |
| Monoisotopic Mass | 224.06195 |
| Heavy Atoms | 15 |
| Complexity | 355.61868 |
Chemical Identifiers
| CAS Number | 67196-41-2 |
|---|---|
| SMILES | CC1CC=CCC12C(=O)NC(=S)NC2=O |
Product Overview
2,4-Diazaspiro(5.5)undec-8-ene-1,3,5-trione, 11-methyl-3-thioxo- (CAS 67196-41-2), with molecular formula C10H12N2O2S and molecular weight 224.06195 g/mol. IUPAC: 11-methyl-3-sulfanylidene-2,4-diazaspiro[5.5]undec-8-ene-1,5-dione.