4-Bromo-3,5-dimethylphenyl N-methylcarbamate
(4-bromo-3,5-dimethylphenyl) N-methylcarbamate
Also Known As: 4-Bromo-3,5-dimethylphenyl N-methylcarbamate|BDMC|ACMC-20amn8|BDMC, analytical standard|4-Bromo-3,5-Dimethylphenyl-N-Methylcarbamate|(4-bromo-3,5-dimethylphenyl) N-methylcarbamate|4-Bromo-3,5-dimethylphenyl methylcarbamate|1-NAPHTHOL-3,8-DISULFONICACID|4-Bromo-35-dimethylphenyl-N-methylcarbamate|J1.472.318H|4-bromo-3,5-dimethyl phenyl-N-methyl carbamate|(4-bromo-3,5-dimethyl-phenyl) N-methylcarbamate|4-Bromo-3,5-dimethylphenyl N-methylcarbamate, 98%|I14-52417|Methylcarbamic acid 3,5-dimethyl-4-bromophenyl ester|Methylcarbamic acid 4-bromo-3,5-dimethylphenyl ester|623-538-3
| Molecular Formula | C10H12BrNO2 |
|---|---|
| Molecular Weight | 257.00513 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 38.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 257.00513 |
| Monoisotopic Mass | 257.00513 |
| Heavy Atoms | 14 |
| Complexity | 198.0 |
Chemical Identifiers
| CAS Number | 672-99-1 |
|---|---|
| SMILES | CC1=CC(=CC(=C1Br)C)OC(=O)NC |
| InChIKey | ZOZFMTULOYRWEL-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Bromo-3,5-dimethylphenyl N-methylcarbamate (CAS 672-99-1), with molecular formula C10H12BrNO2 and molecular weight 257.00513 g/mol. IUPAC: (4-bromo-3,5-dimethylphenyl) N-methylcarbamate.