2-(1H-Indol-3-yl)-4-oxo-4-phenylbutanoic acid
2-(1H-indol-3-yl)-4-oxo-4-phenylbutanoic acid
Also Known As: PEO-IAA|2-(1H-Indol-3-yl)-4-oxo-4-phenylbutanoic acid|2-indol-3-yl-4-oxo-4-phenylbutanoic acid|3,5-Difluorobenzhydrazide|2-(1H-Indol-3-yl)-4-oxo-4-phenyl-butyric acid|Oprea1_085797|Oprea1_800638|EX-A4153|KS-000028IC|s6788|MS-6212|alpha-Phenacyl-1H-indole-3-acetic acid|1-Boc-2,3-dihydro-7-indolecarbaldehyde|BAS 04207246|2-Inodl-3-yl-4-oxo-4-phenylbutanoic acid
| Molecular Formula | C18H15NO3 |
|---|---|
| Molecular Weight | 293.1052 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 70.2 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 293.1052 |
| Monoisotopic Mass | 293.1052 |
| Heavy Atoms | 22 |
| Complexity | 417.0 |
Chemical Identifiers
| CAS Number | 6726-65-4 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(=O)CC(C2=CNC3=CC=CC=C32)C(=O)O |
| InChIKey | SJVMWLJNHPHNPT-UHFFFAOYSA-N |
Product Overview
2-(1H-Indol-3-yl)-4-oxo-4-phenylbutanoic acid (CAS 6726-65-4), with molecular formula C18H15NO3 and molecular weight 293.1052 g/mol. IUPAC: 2-(1H-indol-3-yl)-4-oxo-4-phenylbutanoic acid.
2-(1H-Indol-3-yl)-4-oxo-4-phenylbutanoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »