5-bromo-N-[2-(dimethylamino)ethyl]-6-oxopyran-3-carboxamide
5-bromo-N-[2-(dimethylamino)ethyl]-6-oxopyran-3-carboxamide
Also Known As: 5-bromo-N-[2-(dimethylamino)ethyl]-6-oxopyran-3-carboxamide|3-bromo-N-[2-(dimethylamino)ethyl]-2-oxo-2H-pyran-5-carboxamide|5-bromo-N-(2-dimethylaminoethyl)-6-oxopyran-3-carboxamide|5-bromo-N-[2-(dimethylamino)ethyl]-6-keto-pyran-3-carboxamide|5-bromo-N-[2-(dimethylamino)ethyl]-6-oxo-3-pyrancarboxamide|3-bromo-N-(2-(dimethylamino)ethyl)-2-oxo-2H-pyran-5-carboxamide|5-bromanyl-N-[2-(dimethylamino)ethyl]-6-oxidanylidene-pyran-3-carboxamide
| Molecular Formula | C10H13BrN2O3 |
|---|---|
| Molecular Weight | 288.01096 g/mol |
| LogP | 0.7 |
| Topological Polar Surface Area | 58.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 288.01096 |
| Monoisotopic Mass | 288.01096 |
| Heavy Atoms | 16 |
| Complexity | 361.0 |
Chemical Identifiers
| CAS Number | 672902-85-1 |
|---|---|
| SMILES | CN(C)CCNC(=O)C1=COC(=O)C(=C1)Br |
| InChIKey | QWECBWLQUCGEJG-UHFFFAOYSA-N |
Product Overview
5-bromo-N-[2-(dimethylamino)ethyl]-6-oxopyran-3-carboxamide (CAS 672902-85-1), with molecular formula C10H13BrN2O3 and molecular weight 288.01096 g/mol. IUPAC: 5-bromo-N-[2-(dimethylamino)ethyl]-6-oxopyran-3-carboxamide.
5-bromo-N-[2-(dimethylamino)ethyl]-6-oxopyran-3-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »