AC1MHGOX
2-(diethylamino)ethyl 2-cyclopent-2-en-1-yl-2-(2,3-dihydro-1H-inden-1-yl)acetate;hydrochloride
Also Known As: alpha-Cyclopent-2-en-1-ylindan-1-acetic acid hydrochloride|1-Indanacetic acid, alpha-cyclopent-2-en-1-yl-, 2-(diethylamino)ethyl ester, hydrochloride|2-(Diethylamino)ethyl (cyclopent-2-en-1-yl)(2,3-dihydro-1H-inden-1-yl)acetate--hydrogen chloride (1/1)|1H-Indene-1-acetic acid, .alpha.-2-cyclopenten-1-yl-2,3-dihydro-, 2-(diethylamino)ethyl ester, hydrochloride|2-diethylaminoethyl 2-cyclopent-2-en-1-yl-2-(2,3-dihydro-1H-inden-1-yl)acetate hydrochloride
| Molecular Formula | C22H32ClNO2 |
|---|---|
| Molecular Weight | 377.21216 g/mol |
| LogP | 4.6056 |
| Topological Polar Surface Area | 29.54 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Exact Mass | 377.21216 |
| Monoisotopic Mass | 377.21216 |
| Heavy Atoms | 26 |
| Complexity | 611.91473 |
Chemical Identifiers
| CAS Number | 67293-00-9 |
|---|---|
| SMILES | CCN(CC)CCOC(=O)C(C1CCC=C1)C2CCC3=CC=CC=C23.Cl |
Product Overview
AC1MHGOX (CAS 67293-00-9), with molecular formula C22H32ClNO2 and molecular weight 377.21216 g/mol. IUPAC: 2-(diethylamino)ethyl 2-cyclopent-2-en-1-yl-2-(2,3-dihydro-1H-inden-1-yl)acetate;hydrochloride.