Phenethylamine, N-ethyl-N-(4-hydroxybutyl)-, 3,4,5-trimethoxybenzoate (ester)
4-[ethyl(2-phenylethyl)amino]butyl 3,4,5-trimethoxybenzoate
Also Known As: Phenethylamine, N-ethyl-N-(4-hydroxybutyl)-, 3,4,5-trimethoxybenzoate (ester)|3,4,5-Trimethoxybenzoicacid4-[ethyl amino]butylester|N-Ethyl-N-(4-hydroxybutyl)phenethylamine 3,4,5-trimethoxybenzoate (ester)|4-[ethyl(2-phenylethyl)amino]butyl 3,4,5-trimethoxybenzoate|4-[ethyl(phenethyl)amino]butyl 3,4,5-trimethoxybenzoate|3,4,5-Trimethoxybenzoic acid 4-[ethyl(phenethyl)amino]butyl ester|Benzoic acid, 3,4,5-trimethoxy-, 4-[ethyl(2-phenylethyl)amino]butyl ester
| Molecular Formula | C24H33NO5 |
|---|---|
| Molecular Weight | 415.23587 g/mol |
| LogP | 4.214 |
| Topological Polar Surface Area | 57.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Exact Mass | 415.23587 |
| Monoisotopic Mass | 415.23587 |
| Heavy Atoms | 30 |
| Complexity | 753.4158 |
Chemical Identifiers
| CAS Number | 67293-34-9 |
|---|---|
| SMILES | CCN(CCCCOC(=O)C1=CC(=C(C(=C1)OC)OC)OC)CCC2=CC=CC=C2 |
Product Overview
Phenethylamine, N-ethyl-N-(4-hydroxybutyl)-, 3,4,5-trimethoxybenzoate (ester) (CAS 67293-34-9), with molecular formula C24H33NO5 and molecular weight 415.23587 g/mol. IUPAC: 4-[ethyl(2-phenylethyl)amino]butyl 3,4,5-trimethoxybenzoate.