Phenethylamine, N-ethyl-N-(4-hydroxypentyl)-, 3,4,5-trimethoxybenzoate (ester)
5-[ethyl(2-phenylethyl)amino]pentan-2-yl 3,4,5-trimethoxybenzoate
Also Known As: N-Ethyl-N-(4-hydroxypentyl)phenethylamine 3,4,5-trimethoxybenzoate (ester)|Phenethylamine, N-ethyl-N-(4-hydroxypentyl)-, 3,4,5-trimethoxybenzoate (ester)|3,4,5-Trimethoxybenzoicacid4-[ethyl amino]-1-methylbutylester|5-[ethyl(2-phenylethyl)amino]pentan-2-yl 3,4,5-trimethoxybenzoate|5-[ethyl(phenethyl)amino]pentan-2-yl 3,4,5-trimethoxybenzoate|3,4,5-Trimethoxybenzoic acid 4-[ethyl(phenethyl)amino]-1-methylbutyl ester|Benzoic acid, 3,4,5-trimethoxy-, 4-[ethyl(2-phenylethyl)amino]-1-methylbutyl ester
| Molecular Formula | C25H35NO5 |
|---|---|
| Molecular Weight | 429.25153 g/mol |
| LogP | 4.6025 |
| Topological Polar Surface Area | 57.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Exact Mass | 429.25153 |
| Monoisotopic Mass | 429.25153 |
| Heavy Atoms | 31 |
| Complexity | 783.8097 |
Chemical Identifiers
| CAS Number | 67293-46-3 |
|---|---|
| SMILES | CCN(CCCC(C)OC(=O)C1=CC(=C(C(=C1)OC)OC)OC)CCC2=CC=CC=C2 |
Product Overview
Phenethylamine, N-ethyl-N-(4-hydroxypentyl)-, 3,4,5-trimethoxybenzoate (ester) (CAS 67293-46-3), with molecular formula C25H35NO5 and molecular weight 429.25153 g/mol. IUPAC: 5-[ethyl(2-phenylethyl)amino]pentan-2-yl 3,4,5-trimethoxybenzoate.