Phenethylamine, N-ethyl-N-(3-hydroxypropyl)-, 3,4,5-trimethoxybenzoate (ester)
3-[ethyl(2-phenylethyl)amino]propyl 3,4,5-trimethoxybenzoate
Also Known As: 3,4,5-Trimethoxybenzoicacid3- propylester|3-(N-Ethyl-N-phenethylamino)propyl 3,4,5-trimethoxybenzoate|Phenethylamine, N-ethyl-N-(3-hydroxypropyl)-, 3,4,5-trimethoxybenzoate (ester)|Benzoic acid, 3,4,5-trimethoxy-, 3-(N-ethyl-N-phenethylamino)propyl ester|N-Ethyl-N-(3-hydroxypropyl)phenethylamine 3,4,5-trimethoxybenzoate (ester)|3-[ethyl(2-phenylethyl)amino]propyl 3,4,5-trimethoxybenzoate|3-[ethyl(phenethyl)amino]propyl 3,4,5-trimethoxybenzoate|3,4,5-Trimethoxybenzoic acid 3-(N-ethyl-N-phenethylamino)propyl ester|Benzoic acid, 3,4,5-trimethoxy-, 3-[ethyl(2-phenylethyl)amino]propyl ester
| Molecular Formula | C23H31NO5 |
|---|---|
| Molecular Weight | 401.2202 g/mol |
| LogP | 4.4 |
| Topological Polar Surface Area | 57.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Exact Mass | 401.2202 |
| Monoisotopic Mass | 401.2202 |
| Heavy Atoms | 29 |
| Complexity | 441.0 |
Chemical Identifiers
| CAS Number | 67293-50-9 |
|---|---|
| SMILES | CCN(CCCOC(=O)C1=CC(=C(C(=C1)OC)OC)OC)CCC2=CC=CC=C2 |
| InChIKey | CREIPIKTTPHWRL-UHFFFAOYSA-N |
Product Overview
Phenethylamine, N-ethyl-N-(3-hydroxypropyl)-, 3,4,5-trimethoxybenzoate (ester) (CAS 67293-50-9), with molecular formula C23H31NO5 and molecular weight 401.2202 g/mol. IUPAC: 3-[ethyl(2-phenylethyl)amino]propyl 3,4,5-trimethoxybenzoate.