4-(4-{[2-(dimethylamino)ethyl]amino}-3-nitrophenyl)phthalazin-1(2H)-one
4-[4-[2-(dimethylamino)ethylamino]-3-nitrophenyl]-2H-phthalazin-1-one
Also Known As: A3322/0141115|4-(4-{[2-(dimethylamino)ethyl]amino}-3-nitrophenyl)phthalazin-1(2H)-one|4-(4-((2-(dimethylamino)ethyl)amino)-3-nitrophenyl)phthalazin-1(2H)-one|4-(4-{[2-(dimethylamino)ethyl]amino}-3-nitrophenyl)-1(2H)-phthalazinone|4-[4-(2-dimethylaminoethylamino)-3-nitrophenyl]-2H-phthalazin-1-one|4-(4-{[2-(DIMETHYLAMINO)ETHYL]AMINO}-3-NITROPHENYL)-1,2-DIHYDROPHTHALAZIN-1-ONE
| Molecular Formula | C18H19N5O3 |
|---|---|
| Molecular Weight | 353.1488 g/mol |
| LogP | 2.4718 |
| Topological Polar Surface Area | 104.16 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Exact Mass | 353.1488 |
| Monoisotopic Mass | 353.1488 |
| Heavy Atoms | 26 |
| Complexity | 1013.1243 |
Chemical Identifiers
| CAS Number | 674329-27-2 |
|---|---|
| SMILES | CN(C)CCNC1=C(C=C(C=C1)C2=NNC(=O)C3=CC=CC=C32)[N+](=O)[O-] |
Product Overview
4-(4-{[2-(dimethylamino)ethyl]amino}-3-nitrophenyl)phthalazin-1(2H)-one (CAS 674329-27-2), with molecular formula C18H19N5O3 and molecular weight 353.1488 g/mol. IUPAC: 4-[4-[2-(dimethylamino)ethylamino]-3-nitrophenyl]-2H-phthalazin-1-one.
4-(4-{[2-(dimethylamino)ethyl]amino}-3-nitrophenyl)phthalazin-1(2H)-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »