(E)-3-(3-Bromo-4-fluorophenyl)acryloyl chloride
(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl chloride
Also Known As: (E)-3-(3-Bromo-4-fluorophenyl)acryloyl chloride|(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl chloride|1,4-Benzenedicarbonitrile NN'-dioxide|QC-8004|3-(3-Bromo-4-fluorophenyl)acryloyl chloride|3-(3-bromo-4-fluoro-phenyl)-acryloyl chloride|(E)-3-(3-Bromo-4-fluorophenyl)acryloylchloride|(2E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl chloride|(E)-3-(3-bromo-4-fluoro-phenyl)prop-2-enoyl chloride
| Molecular Formula | C9H5BrClFO |
|---|---|
| Molecular Weight | 261.91962 g/mol |
| LogP | 3.3668 |
| Topological Polar Surface Area | 17.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 261.91962 |
| Monoisotopic Mass | 261.91962 |
| Heavy Atoms | 13 |
| Complexity | 362.6324 |
Chemical Identifiers
| CAS Number | 676348-50-8 |
|---|---|
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)Cl)Br)F |
Product Overview
(E)-3-(3-Bromo-4-fluorophenyl)acryloyl chloride (CAS 676348-50-8), with molecular formula C9H5BrClFO and molecular weight 261.91962 g/mol. IUPAC: (E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl chloride.
(E)-3-(3-Bromo-4-fluorophenyl)acryloyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »