2-(Phenylthio)aniline hydrochloride
2-phenylsulfanylaniline;hydrochloride
Also Known As: 2-(Phenylthio)aniline hydrochloride|2-(Phenylthio)aniline|2-Aminodiphenyl Sulfide|1-Methyl-2-pyrrolidone|2-phenylsulfanylaniline;hydrochloride|2-phenylsulfanylaniline hydrochloride|2-Aminodiphenyl Sulfide Hydrochloride|2-(Phenylsulfanyl)aniline hydrochloride|Aniline, o-(phenylthio)-, hydrochloride|Benzenamine, 2-(phenylthio)-, hydrochloride|2-(Phenylsulfanyl)aniline--hydrogen chloride (1/1)|Benzenamine, 2-(phenylthio)-, hydrochloride (1:1)
| Molecular Formula | C12H12ClNS |
|---|---|
| Molecular Weight | 237.0379 g/mol |
| LogP | 3.8418 |
| Topological Polar Surface Area | 51.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 237.0379 |
| Monoisotopic Mass | 237.0379 |
| Heavy Atoms | 15 |
| Complexity | 166.0 |
Chemical Identifiers
| CAS Number | 6764-13-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)SC2=CC=CC=C2N.Cl |
| InChIKey | XCFXJRCTEOTOJD-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(Phenylthio)aniline hydrochloride (CAS 6764-13-2), with molecular formula C12H12ClNS and molecular weight 237.0379 g/mol. IUPAC: 2-phenylsulfanylaniline;hydrochloride.