3-(4-Fluorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide
3-(4-fluorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide
Also Known As: 3-(4-fluorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide|3-(4-Fluorophenyl)-N,5-dimethylisoxazole-4-carboxamide|N,5-DIMETHYL-3-(4-FLUOROPHENYL)-4-ISOXAZOLECARBOXAMIDE|5,N-Dimethyl-3-(4-fluorophenyl)-4-isoxazolecarboxamide|3-(4-Fluorophenyl)-n,5-dimethyl-oxazole-4-carboxamide|3-(p-Fluorophenyl)-N,5-dimethyl-4-isoxazolecarboxamide|3-(4-Fluorophenyl)-N,5-dimethyl-4-isoxazolecarboxamide #
| Molecular Formula | C12H11FN2O2 |
|---|---|
| Molecular Weight | 234.08046 g/mol |
| LogP | 1.8 |
| Topological Polar Surface Area | 55.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 234.08046 |
| Monoisotopic Mass | 234.08046 |
| Heavy Atoms | 17 |
| Complexity | 280.0 |
Chemical Identifiers
| CAS Number | 67764-99-2 |
|---|---|
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)F)C(=O)NC |
| InChIKey | DVDZYPBJVUNUKM-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3-(4-Fluorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide (CAS 67764-99-2), with molecular formula C12H11FN2O2 and molecular weight 234.08046 g/mol. IUPAC: 3-(4-fluorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide.