Methyl 2-{[(benzyloxy)carbonyl]amino}propanoate
methyl 2-(phenylmethoxycarbonylamino)propanoate
Also Known As: Z-Ala-OMe|Cbz-D-Ala-OMe|Z-L-Alanine methyl ester|N-Alpha-carbobenzoxy-d-alanine methyl ester|CBZ-D-ALANINE METHYL ESTER|methyl N-[(benzyloxy)carbonyl]alaninate|methyl 2-(benzyloxycarbonylamino)propanoate|methyl 2-(phenylmethoxycarbonylamino)propanoate|METHYL 2-{[(BENZYLOXY)CARBONYL]AMINO}PROPANOATE|CARBOBENZYLOXY-DL-ALANINE METHYL ESTER|J1.094.899A|(S)-methyl 2-(benzyloxycarbonylamino)propanoate|methyl 2-[(phenylmethoxy)carbonylamino]propanoate|methyl (2S)-2-(phenylmethoxycarbonylamino)propanoate|(R)-Methyl 2-(((benzyloxy)carbonyl)amino)propanoate|2-(Benzyloxycarbonylamino)propionic acid methyl ester|2-[(Benzyloxycarbonyl)amino]propionic acid methyl ester
| Molecular Formula | C12H15NO4 |
|---|---|
| Molecular Weight | 237.10011 g/mol |
| LogP | 1.8 |
| Topological Polar Surface Area | 64.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 237.10011 |
| Monoisotopic Mass | 237.10011 |
| Heavy Atoms | 17 |
| Complexity | 261.0 |
Chemical Identifiers
| CAS Number | 67799-99-9 |
|---|---|
| SMILES | CC(C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
| InChIKey | OMDVFTVXPVXANK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 2-{[(benzyloxy)carbonyl]amino}propanoate (CAS 67799-99-9), with molecular formula C12H15NO4 and molecular weight 237.10011 g/mol. IUPAC: methyl 2-(phenylmethoxycarbonylamino)propanoate.