Methyl Perfluorobutyl Ketone
3,3,4,4,5,5,6,6,6-nonafluorohexan-2-one
Also Known As: Methyl Nonafluorobutyl Ketone|Methyl Perfluorobutyl Ketone|3,3,4,4,5,5,6,6,6-nonafluorohexan-2-one|1H,1H,1H-Nonafluoro-2-hexanone|HFK-549mccc|Methyl Perfluoro-n-butyl Ketone|1H,1H,1H-Perfluoro-2-hexanone|1H,1H,1H-Perfluorohexan-2-one|ACMC-209o11|1,1,1,2,2,3,3,4,4-Nonafluoro-5-hexanone|Methyl nonafluorobutyl ketone 100g|3,3,4,4,5,5,6,6,6-Nonafluoro-2-hexanone|7977AE|FS-4360|2-Hexanone, 3,3,4,4,5,5,6,6,6-nonafluoro-|18-Methyl-estra-4,9- diene -3,17-dione|I14-29319|1H,1H,1H-Nonafluorohexan-2-one; 1H,1H,1H-Perfluoro-2-hexanone|1H,1H,1H-Nonafluoro-2-hexanone; 3,3,4,4,5,5,6,6,6-Nonafluoro-2-hexanone; Methyl perfluorobutyl ketone|671-222-9
| Molecular Formula | C6H3F9O |
|---|---|
| Molecular Weight | 262.00403 g/mol |
| LogP | 3.0436 |
| Topological Polar Surface Area | 17.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 262.00403 |
| Monoisotopic Mass | 262.00403 |
| Heavy Atoms | 16 |
| Complexity | 288.86456 |
Chemical Identifiers
| CAS Number | 678-18-2 |
|---|---|
| SMILES | CC(=O)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Product Overview
Methyl Perfluorobutyl Ketone (CAS 678-18-2), with molecular formula C6H3F9O and molecular weight 262.00403 g/mol. IUPAC: 3,3,4,4,5,5,6,6,6-nonafluorohexan-2-one.