Einecs 267-551-9
methyl sulfate;2-(4-methyl-1,2,4-triazol-4-ium-1-yl)benzo[f]chromen-3-one
Also Known As: EINECS 267-551-9|4-Methyl-1-(3-oxo-3H-naphtho(2,1-b)pyran-2-yl)-1H-1,2,4-triazoliummethyl sulphate|4-Methyl-1-(3-oxo-3H-benzo[f]chromen-2-yl)-4H-1,2,4-triazol-1-ium methyl sulfate|4-Methyl-1-(3-oxo-3H-naphtho[2,1-b]pyran-2-yl)-1H-1,2,4-triazol-4-ium methyl sulfate|4-Methyl-1-(3-oxo-3H-naphtho[2,1-b]pyran-2-yl)-1H-1,2,4-triazolium methyl sulfate|methyl sulfate; 2-(4-methyl-1,2,4-triazol-4-ium-1-yl)benzo[f]chromen-3-one
| Molecular Formula | C17H15N3O6S |
|---|---|
| Molecular Weight | 389.06815 g/mol |
| LogP | 1.0494 |
| Topological Polar Surface Area | 118.34 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Exact Mass | 389.06815 |
| Monoisotopic Mass | 389.06815 |
| Heavy Atoms | 27 |
| Complexity | 1276.8115 |
Chemical Identifiers
| CAS Number | 67883-54-9 |
|---|---|
| SMILES | C[N+]1=CN(N=C1)C2=CC3=C(C=CC4=CC=CC=C43)OC2=O.COS(=O)(=O)[O-] |
Product Overview
Einecs 267-551-9 (CAS 67883-54-9), with molecular formula C17H15N3O6S and molecular weight 389.06815 g/mol. IUPAC: methyl sulfate;2-(4-methyl-1,2,4-triazol-4-ium-1-yl)benzo[f]chromen-3-one.
Einecs 267-551-9 is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »