Cyclohexanecarboxylic acid, 4-butyl-, 4-methoxyphenyl ester, trans-
(4-methoxyphenyl) 4-butylcyclohexane-1-carboxylate
Also Known As: 4-Methoxyphenyl 4-butylcyclohexanecarboxylate|(4-methoxyphenyl) 4-butylcyclohexane-1-carboxylate|NCGC00322648-01|4-methoxyphenyl trans-4-butylcyclohexanecarboxylate|Cyclohexanecarboxylic acid, 4-butyl-, 4-methoxyphenyl ester, trans-|4-Methoxyphenyl 4-butylcyclohexanecarboxylate #|AB01317237-02|Cyclohexanecarboxylic acid, 4-butyl-, 4-methoxyphenyl ester|4-Methoxyphenyl trans-4-butylcycolhexanecarboxylate|4-methoxyphenyl (1s,4r)-4-butylcyclohexane-1-carboxylate|4-METHOXYPHENYL 4-BUTYLCYCLOHEXANE-1-CARBOXYLATE|4alpha-Butylcyclohexane-1beta-carboxylic acid 4-methoxyphenyl ester|4beta-Butyl-1alpha-cyclohexanecarboxylic acid p-methoxyphenyl ester
| Molecular Formula | C18H26O3 |
|---|---|
| Molecular Weight | 290.1882 g/mol |
| LogP | 5.6 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Exact Mass | 290.1882 |
| Monoisotopic Mass | 290.1882 |
| Heavy Atoms | 21 |
| Complexity | 300.0 |
Chemical Identifiers
| CAS Number | 67950-89-4 |
|---|---|
| SMILES | CCCCC1CCC(CC1)C(=O)OC2=CC=C(C=C2)OC |
| InChIKey | SATRKQXJJHOCFK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Cyclohexanecarboxylic acid, 4-butyl-, 4-methoxyphenyl ester, trans- (CAS 67950-89-4), with molecular formula C18H26O3 and molecular weight 290.1882 g/mol. IUPAC: (4-methoxyphenyl) 4-butylcyclohexane-1-carboxylate.