exo-3-(3,3-Dimethylbicyclo(2.2.1)hept-2-yl)acrylic acid
(E)-3-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid
Also Known As: EINECS 267-960-2|EINECS 286-844-2|exo-3-(3,3-Dimethylbicyclo(2.2.1)hept-2-yl)acrylic acid|3-(3,3-Dimethylbicyclo(2.2.1)hept-2-yl)acrylic acid|3-(3,3-DIMETHYLBICYCLO[2.2.1]HEPT-2-YL)ACRYLIC ACID|3-(3,3-Dimethylbicyclo[2.2.1]heptan-2-yl)propenoic acid|3-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid|(E)-3-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid|EXO-3-(3,3-DIMETHYLBICYCLO[2.2.1]HEPT-2-YL)ACRYLIC ACID|3-{3,3-DIMETHYLBICYCLO[2.2.1]HEPTAN-2-YL}PROP-2-ENOIC ACID
| Molecular Formula | C12H18O2 |
|---|---|
| Molecular Weight | 194.13068 g/mol |
| LogP | 2.6995 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 194.13068 |
| Monoisotopic Mass | 194.13068 |
| Heavy Atoms | 14 |
| Complexity | 278.04633 |
Chemical Identifiers
| CAS Number | 67968-07-4 |
|---|---|
| SMILES | CC1(C2CCC(C2)C1/C=C/C(=O)O)C |
Product Overview
exo-3-(3,3-Dimethylbicyclo(2.2.1)hept-2-yl)acrylic acid (CAS 67968-07-4), with molecular formula C12H18O2 and molecular weight 194.13068 g/mol. IUPAC: (E)-3-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid.