(4e)-4-{[4-(Dimethylamino)phenyl]imino}-3-methylcyclohexa-2,5-dien-1-one
4-[4-(dimethylamino)phenyl]imino-3-methylcyclohexa-2,5-dien-1-one
Also Known As: Indoaniline,N,3-trimethyl-|Indoaniline, N,N,3-trimethyl-|KST-1A8245|(4e)-4-{[4-(dimethylamino)phenyl]imino}-3-methylcyclohexa-2,5-dien-1-one|p-Benzoquinone imine, N-(p-dimethylaminophenyl)-3-methyl-|2,5-cyclohexadien-1-one, 4-[[4-(dimethylamino)phenyl]imino]-3-methyl-|4-[4-(dimethylamino)phenyl]imino-3-methyl-cyclohexa-2,5-dien|4-(4-dimethylaminophenyl)imino-3-methylcyclohexa-2,5-dien-1-one|4-[4-(dimethylamino)phenyl]imino-3-methylcyclohexa-2,5-dien-1-one
| Molecular Formula | C15H16N2O |
|---|---|
| Molecular Weight | 240.12627 g/mol |
| LogP | 2.4 |
| Topological Polar Surface Area | 32.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 240.12627 |
| Monoisotopic Mass | 240.12627 |
| Heavy Atoms | 18 |
| Complexity | 410.0 |
Chemical Identifiers
| CAS Number | 67979-40-2 |
|---|---|
| SMILES | CC1=CC(=O)C=CC1=NC2=CC=C(C=C2)N(C)C |
| InChIKey | IUCMTDKRLIEOCH-UHFFFAOYSA-N |
Product Overview
(4e)-4-{[4-(Dimethylamino)phenyl]imino}-3-methylcyclohexa-2,5-dien-1-one (CAS 67979-40-2), with molecular formula C15H16N2O and molecular weight 240.12627 g/mol. IUPAC: 4-[4-(dimethylamino)phenyl]imino-3-methylcyclohexa-2,5-dien-1-one.