2-Butenedioic acid (2Z)-, 1,4-bis(2,4,6-tribromophenyl) ester
bis(2,4,6-tribromophenyl) (E)-but-2-enedioate
Also Known As: BIS FUMARATE|2,4,6-Tribromophenyl maleate|2,4,6-Tribromophenyl fumarate|Bis(2,4,6-tribromophenyl) fumarate|EINECS 246-029-4|EINECS 268-437-1|Bis(2,4,6-tribromophenyl) maleate|BIS-(2,4,6-TRIBROMOPHENYL) FUMARATE|Fumaric acid bis(2,4,6-tribromophenyl) ester|2-Butenedioic acid (2E)-, 1,4-bis(2,4,6-tribromophenyl) ester|Fumaric acid, bis(2,4,6-tribromophenyl) ester|2-Butenedioic acid (2E)-, bis(2,4,6-tribromophenyl) ester|bis(2,4,6-tribromophenyl) (E)-but-2-enedioate|BIS(2,4,6-TRIBROMOPHENYL) (2E)-BUT-2-ENEDIOATE|2-Butenedioic acid (2Z)-, bis(2,4,6-tribromophenyl) ester|2-Butenedioic acid (2Z)-, 1,4-bis(2,4,6-tribromophenyl) ester
| Molecular Formula | C16H6Br6O4 |
|---|---|
| Molecular Weight | 735.5366 g/mol |
| LogP | 7.3288 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 735.5366 |
| Monoisotopic Mass | 741.5305 |
| Heavy Atoms | 26 |
| Complexity | 790.0984 |
Chemical Identifiers
| CAS Number | 68084-32-2 |
|---|---|
| SMILES | C1=C(C=C(C(=C1Br)OC(=O)/C=C/C(=O)OC2=C(C=C(C=C2Br)Br)Br)Br)Br |
Product Overview
2-Butenedioic acid (2Z)-, 1,4-bis(2,4,6-tribromophenyl) ester (CAS 68084-32-2), with molecular formula C16H6Br6O4 and molecular weight 735.5366 g/mol. IUPAC: bis(2,4,6-tribromophenyl) (E)-but-2-enedioate.