AC1O5C8S
2-hydroxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;styrene
Also Known As: (C8-H8.C7-H12-O3.C4-H6-O2)x-|2-Hydroxypropyl methacrylate, methacrylic acid, styrene resin|2-hydroxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;styrene|2-hydroxypropyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid; styrene|2-Propenoic acid, 2-methyl-, polymer with ethenylbenzene and 1,2-propanediol mono(2-methyl-2-propeno|2-Propenoic acid, 2-methyl-, polymer with ethenylbenzene and 1,2-propanediol mono(2-methyl-2-propenoate)|2-Propenoic acid, 2-methyl-, polymer with ethenylbenzene and 2-hydroxypropyl 2-methyl-2-propenoate
| Molecular Formula | C19H26O5 |
|---|---|
| Molecular Weight | 334.178 g/mol |
| LogP | 3.4632 |
| Topological Polar Surface Area | 83.83 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 334.178 |
| Monoisotopic Mass | 334.178 |
| Heavy Atoms | 24 |
| Complexity | 532.1354 |
Chemical Identifiers
| CAS Number | 68239-97-4 |
|---|---|
| SMILES | CC(COC(=O)C(=C)C)O.CC(=C)C(=O)O.C=CC1=CC=CC=C1 |
Product Overview
AC1O5C8S (CAS 68239-97-4), with molecular formula C19H26O5 and molecular weight 334.178 g/mol. IUPAC: 2-hydroxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;styrene.