2-Ethylhexyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;styrene
2-ethylhexyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;styrene
Also Known As: (C11-H20-O2.C8-H14-O2.C8-H8)x-|Styrene, 2-ethylhexyl acrylate, isobutyl methacrylate polymer|2-ethylhexyl prop-2-enoate; 2-methylpropyl 2-methylprop-2-enoate; styrene|2-Propenoic acid, 2-methyl-, 2-methylpropyl ester, polymer with ethenylbenzene and 2-ethylhexyl 2-propenoate|Ethenylbenzene, 2-ethylhexyl propenoate, 2-methylpropyl 2-methyl-2-propenoate polymer
| Molecular Formula | C27H42O4 |
|---|---|
| Molecular Weight | 430.30832 g/mol |
| LogP | 7.0233 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Exact Mass | 430.30832 |
| Monoisotopic Mass | 430.30832 |
| Heavy Atoms | 31 |
| Complexity | 356.0 |
Chemical Identifiers
| CAS Number | 68240-06-2 |
|---|---|
| SMILES | CCCCC(CC)COC(=O)C=C.CC(C)COC(=O)C(=C)C.C=CC1=CC=CC=C1 |
| InChIKey | PBDORTHEWGDMCJ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Ethylhexyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;styrene (CAS 68240-06-2), with molecular formula C27H42O4 and molecular weight 430.30832 g/mol. IUPAC: 2-ethylhexyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;styrene.