Ethene;3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene;1,1,2,2-tetrafluoroethene
ethene;3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene;1,1,2,2-tetrafluoroethene
Also Known As: (C6-H3-F9.C2-H4.C2-F4)x-|1-Hexene, 3,3,4,4,5,5,6,6,6-nonafluoro-, polymer with ethene and tetrafluoroethene|TERPOLYMER OF TETRAFLUOROETHYLENE-ETHYLENE-NONAFLUOROHEXYLENE|ethene;3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene;1,1,2,2-tetrafluoroethene|1-Hexene, 3,3,4,4,5,5,6,6,6-nonafluoro-, polymer with ethene andtetrafluoroethene|ethene; 3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene; 1,1,2,2-tetrafluoroethene|1-Hexene, 3,3,4,4,5,5,6,6,6-nonafluoro-, polymer with ethene and 1,1,2,2-tetrafluoroethene
| Molecular Formula | C10H7F13 |
|---|---|
| Molecular Weight | 374.03403 g/mol |
| LogP | 6.4338 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Exact Mass | 374.03403 |
| Monoisotopic Mass | 374.03403 |
| Heavy Atoms | 23 |
| Complexity | 303.0 |
Chemical Identifiers
| CAS Number | 68258-85-5 |
|---|---|
| SMILES | C=C.C=CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F.C(=C(F)F)(F)F |
| InChIKey | XSPFSRILRCQVRO-UHFFFAOYSA-N |
Product Overview
Ethene;3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene;1,1,2,2-tetrafluoroethene (CAS 68258-85-5), with molecular formula C10H7F13 and molecular weight 374.03403 g/mol. IUPAC: ethene;3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene;1,1,2,2-tetrafluoroethene.