Androst-5-en-17-one
(8R,9S,10R,13S,14S)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one
Also Known As: Androst-5-en-17-one|5-androsten-17-one|Androst-5-en-7-one|CS-W023113|(8R,9S,10R,13S,14S)-10,13-Dimethyl-3,4,7,8,9,10,11,12,13,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17(2H)-one|Androst-5-en-17-one(3-Deoxydehydroepiandrosterone)|(8R,9S,10R,13S,14S)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one|(3aS,3bR,9aR,9bS,11aS)-9a,11a-dimethyl-1H,2H,3H,3aH,3bH,4H,6H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-1-one
| Molecular Formula | C19H28O |
|---|---|
| Molecular Weight | 272.21402 g/mol |
| LogP | 4.8 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 272.21402 |
| Monoisotopic Mass | 272.21402 |
| Heavy Atoms | 20 |
| Complexity | 476.0 |
Chemical Identifiers
| CAS Number | 6830-13-3 |
|---|---|
| SMILES | C[C@]12CCCCC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C |
| InChIKey | AFGDPPHTYUQKOF-QAGGRKNESA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Androst-5-en-17-one (CAS 6830-13-3), with molecular formula C19H28O and molecular weight 272.21402 g/mol. IUPAC: (8R,9S,10R,13S,14S)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.