4-Fluoro-3-phenoxybenzoic acid
4-fluoro-3-phenoxybenzoic acid
Also Known As: 4-Fluoro-3-phenoxybenzoic acid|Cyfluthrin metabolite|beta-cyfluthrin TP1|Benzoic acid, 4-fluoro-3-phenoxy-|Benzoic acid,4-fluoro-3-phenoxy-|4-Fluoro-3-phenoxy-benzoic acid|4-Fluoro-3-phenoxybenzoicacid|4-luoro-3-phenoxybenzoic acid|m-phenoxy-p-fluorobenzoic alcohol|Benzoicacid,4-fluoro-3-phenoxy-|4-FLUORO-3-PHENOXY BENZOIC ACID|4-fluoro-3-(phenoxy)benzoic acid|FLUORO-3-PHENOXYBENZOIC ACID, 4-|I14-7583|4-Fluoro-3-phenoxy benzoic acid 100 |Ig/mL in Acetonitrile|4-Fluoro-3-phenoxy benzoic acid 100 microg/mL in Acetonitrile|824-489-2
| Molecular Formula | C13H9FO3 |
|---|---|
| Molecular Weight | 232.05357 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 46.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 232.05357 |
| Monoisotopic Mass | 232.05357 |
| Heavy Atoms | 17 |
| Complexity | 263.0 |
Chemical Identifiers
| CAS Number | 68359-53-5 |
|---|---|
| SMILES | C1=CC=C(C=C1)OC2=C(C=CC(=C2)C(=O)O)F |
| InChIKey | VLXNXMTVRWIUJZ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Fluoro-3-phenoxybenzoic acid (CAS 68359-53-5), with molecular formula C13H9FO3 and molecular weight 232.05357 g/mol. IUPAC: 4-fluoro-3-phenoxybenzoic acid.