Methyl 3-hydroxyadamantane-1-carboxylate
methyl 3-hydroxyadamantane-1-carboxylate
Also Known As: methyl 3-hydroxyadamantane-1-carboxylate|ChemDiv1_019054|Oprea1_570507|Methyl 3-hydroxy-1-adamantanecarboxylate|1-methoxycarbonyl-3-adamantanol|HMS641C02|1-methoxycarbonyl-3-hydroxyadamantane|KS-00003H8N|Methyl 3-hydroxyadamantancarboxylate|Methyl3-hydroxyadamantane-1-carboxylate|AS-8105|CM-2301|4CH-024943|I14-9496|Tricyclo(3.3.1.13,7)decane-3-ol-1-carboxylic acid, methyl ester|Tricyclo[3.3.1.13,7decane-3-ol-1-carboxylic acid, methyl ester
| Molecular Formula | C12H18O3 |
|---|---|
| Molecular Weight | 210.1256 g/mol |
| LogP | 1.3 |
| Topological Polar Surface Area | 46.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 210.1256 |
| Monoisotopic Mass | 210.1256 |
| Heavy Atoms | 15 |
| Complexity | 296.0 |
Chemical Identifiers
| CAS Number | 68435-07-4 |
|---|---|
| SMILES | COC(=O)C12CC3CC(C1)CC(C3)(C2)O |
| InChIKey | BEBYNYCNFDDIFE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 3-hydroxyadamantane-1-carboxylate (CAS 68435-07-4), with molecular formula C12H18O3 and molecular weight 210.1256 g/mol. IUPAC: methyl 3-hydroxyadamantane-1-carboxylate.