Urea, N'-(aminoiminomethyl)-N-butyl-N-(2,6-dimethylphenyl)-, monohydrochloride
1-butyl-3-(diaminomethylidene)-1-(2,6-dimethylphenyl)urea;hydrochloride
Also Known As: Urea, 3-amidino-1-butyl-1-(2,6-dimethylphenyl)-, hydrochloride|3-Amidino-1-butyl-1-(2,6-dimethylphenyl)-urea hydrochloride|Urea, N'-(aminoiminomethyl)-N-butyl-N-(2,6-dimethylphenyl)-, monohydrochloride|N'-(Aminoiminomethyl)-N-butyl-N-(2,6-dimethylphenyl)urea hydrochloride|1-butyl-3-(diaminomethylidene)-1-(2,6-dimethylphenyl)urea hydrochloride|N-Butyl-N'-(diaminomethylidene)-N-(2,6-dimethylphenyl)urea--hydrogen chloride (1/1)
| Molecular Formula | C14H23ClN4O |
|---|---|
| Molecular Weight | 298.15604 g/mol |
| LogP | 2.72514 |
| Topological Polar Surface Area | 84.71 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Exact Mass | 298.15604 |
| Monoisotopic Mass | 298.15604 |
| Heavy Atoms | 20 |
| Complexity | 463.8123 |
Chemical Identifiers
| CAS Number | 68656-70-2 |
|---|---|
| SMILES | CCCCN(C1=C(C=CC=C1C)C)C(=O)N=C(N)N.Cl |
Product Overview
Urea, N'-(aminoiminomethyl)-N-butyl-N-(2,6-dimethylphenyl)-, monohydrochloride (CAS 68656-70-2), with molecular formula C14H23ClN4O and molecular weight 298.15604 g/mol. IUPAC: 1-butyl-3-(diaminomethylidene)-1-(2,6-dimethylphenyl)urea;hydrochloride.