Diphenyl methylphosphonate--4,4'-(propane-2,2-diyl)diphenol (1/1)
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;[methyl(phenoxy)phosphoryl]oxybenzene
Also Known As: Phenol, 4,4'-(1-methylethylidene)bis-, polymer with diphenyl methylphosphonate|(C13-H13-O3-P.C15-H16-O2)x-|4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;[methyl(phenoxy)phosphoryl]oxybenzene|Diphenyl methylphosphonate--4,4'-(propane-2,2-diyl)diphenol (1/1)|Phosphonic acid, methyl-, diphenyl ester, polymer with 4,4'-(1-methylethylidene)bis(phenol)-|4-[2-(4-hydroxyphenyl)propan-2-yl]phenol; [methyl(phenoxy)phosphoryl]oxybenzene|Phosphonic acid, P-methyl-, diphenyl ester, polymer with 4,4'-(1-methylethylidene)bis(phenol)|Phosphonic acid, P-methyl-, diphenyl ester, polymer with 4,4'-(1-methylethylidene)bis[phenol]
| Molecular Formula | C28H29O5P |
|---|---|
| Molecular Weight | 476.17526 g/mol |
| LogP | 7.391 |
| Topological Polar Surface Area | 75.99 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 476.17526 |
| Monoisotopic Mass | 476.17526 |
| Heavy Atoms | 34 |
| Complexity | 1112.4009 |
Chemical Identifiers
| CAS Number | 68664-06-2 |
|---|---|
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.CP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2 |
Product Overview
Diphenyl methylphosphonate--4,4'-(propane-2,2-diyl)diphenol (1/1) (CAS 68664-06-2), with molecular formula C28H29O5P and molecular weight 476.17526 g/mol. IUPAC: 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;[methyl(phenoxy)phosphoryl]oxybenzene.