-Lobeline;L-Lobeline
2-[(2S,6R)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methylpiperidin-2-yl]-1-phenylethanone
Also Known As: lobeline|Lobelin|Lobeline [INN]|Lobeline Impurity 4|-Lobeline;L-Lobeline|Lobeline Impurity 14|Lobeline Impurity 15|LOBELINE HYDROCHLORIDE|FS-6759|K652|Lobellin hydrochloride impurity diastereomersD|2-((2S,6R)-6-((S)-2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl)-1-phenylethan-1-one|2-[(2S,6R)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methylpiperidin-2-yl]-1-phenylethanone|2-((2S,6R)-6-((S)-2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl)-1-phenylethan-1-one and 2-((2R,6S)-6-((R)-2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl)-1-phenylethan-1-one
| Molecular Formula | C22H27NO2 |
|---|---|
| Molecular Weight | 337.2042 g/mol |
| LogP | 3.8 |
| Topological Polar Surface Area | 40.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 337.2042 |
| Monoisotopic Mass | 337.2042 |
| Heavy Atoms | 25 |
| Complexity | 412.0 |
Chemical Identifiers
| CAS Number | 686709-76-2 |
|---|---|
| SMILES | CN1[C@H](CCC[C@H]1CC(=O)C2=CC=CC=C2)C[C@@H](C3=CC=CC=C3)O |
| InChIKey | MXYUKLILVYORSK-HKBOAZHASA-N |
Product Overview
-Lobeline;L-Lobeline (CAS 686709-76-2), with molecular formula C22H27NO2 and molecular weight 337.2042 g/mol. IUPAC: 2-[(2S,6R)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methylpiperidin-2-yl]-1-phenylethanone.