TEA-OLEYL SULFATE
2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-18-sulfooctadec-9-enoic acid
Also Known As: TEA-OLEYL SULFATE|18-Sulfooleic acid, triethanolamine salt|EINECS 272-094-3|9-Octadecenoic acid, 18-sulfo-, (9Z)-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1)|18-Sulphooleic acid, compound with 2,2',2''-nitrilotriethanol (1:1)|9-Octadecenoic acid, 18-sulfo-, (9Z)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1)|18- sulphooleic acid, compound with 2, 2', 2''- nitrilotriethanol (1:1)|2-[bis(2-hydroxyethyl)amino]ethanol; (Z)-18-sulfooctadec-9-enoic acid|(9Z)-18-Sulfooctadec-9-enoic acid--2,2',2''-nitrilotri(ethan-1-ol) (1/1)|9-Octadecenoic acid, 18-sulfo-, (Z)-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1)
| Molecular Formula | C24H49NO8S |
|---|---|
| Molecular Weight | 511.3179 g/mol |
| LogP | 3.2417 |
| Topological Polar Surface Area | 155.6 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Exact Mass | 511.3179 |
| Monoisotopic Mass | 511.3179 |
| Heavy Atoms | 34 |
| Complexity | 555.0556 |
Chemical Identifiers
| CAS Number | 68698-78-2 |
|---|---|
| SMILES | C(CCCCS(=O)(=O)O)CCC/C=C\CCCCCCCC(=O)O.C(CO)N(CCO)CCO |
Product Overview
TEA-OLEYL SULFATE (CAS 68698-78-2), with molecular formula C24H49NO8S and molecular weight 511.3179 g/mol. IUPAC: 2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-18-sulfooctadec-9-enoic acid.