2-benzofuran-1,3-dione;(E)-but-2-enedioic acid;dodecane-1,12-diol
2-benzofuran-1,3-dione;(E)-but-2-enedioic acid;dodecane-1,12-diol
Also Known As: (C12-H20-O2.C8-H4-O3.C4-H4-O4)x-|2-Butenedioic acid (2E)-, polymer with 1,3-isobenzofurandione and tricyclodecanedimethanol|2-Butenedioic acid (E)-, polymer with 1,3-isobenzofurandione and tricyclodecanedimethanol|Phthalic anhydride, fumaric acid, tricyclodecanedimethanol polymer|2-benzofuran-1,3-dione; (E)-but-2-enedioic acid; dodecane-1,12-diol|2-Butenedioic acid (E)-, polymer with 1,3-isobenzofurandione andtricyclodecanedimethanol|2-Butenedioic acid, (E)-, polymer with 1,3-isobenzofurandione and tricyclodecanedimethanol
| Molecular Formula | C24H34O9 |
|---|---|
| Molecular Weight | 466.22028 g/mol |
| LogP | 3.581 |
| Topological Polar Surface Area | 158.43 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Exact Mass | 466.22028 |
| Monoisotopic Mass | 466.22028 |
| Heavy Atoms | 33 |
| Complexity | 695.0567 |
Chemical Identifiers
| CAS Number | 68784-89-4 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=O)OC2=O.C(CCCCCCO)CCCCCO.C(=C/C(=O)O)\C(=O)O |
Product Overview
2-benzofuran-1,3-dione;(E)-but-2-enedioic acid;dodecane-1,12-diol (CAS 68784-89-4), with molecular formula C24H34O9 and molecular weight 466.22028 g/mol. IUPAC: 2-benzofuran-1,3-dione;(E)-but-2-enedioic acid;dodecane-1,12-diol.