N-(2-cyanophenyl)-N-(methylsulfonyl)methanesulfonamide
N-(2-cyanophenyl)-N-methylsulfonylmethanesulfonamide
Also Known As: 2-[Bis(methylsulfonyl)amino]benzonitrile|N-(2-cyanophenyl)-N-(methylsulfonyl)methanesulfonamide|Oprea1_357332|o-dimethanesulfonylaminobenzonitrile|N-(2-cyanophenyl)-N-methylsulfonylmethanesulfonamide|5398AJ|Methanesulfonamide, N-(2-cyanophenyl)-N-(methylsulfonyl)-|BB 0242787|2-[bis(methylsulfonyl)amino]benzenecarbonitrile|N-(2-CYANOPHENYL)-N-METHANESULFONYLMETHANESULFONAMIDE|N-(2-cyanophenyl)-N-methylsulfonyl-methanesulfonamide|AN-068/12260010|This type of multiplicative nomenclature is not supported in current version!
| Molecular Formula | C9H10N2O4S2 |
|---|---|
| Molecular Weight | 274.0082 g/mol |
| LogP | 0.28388 |
| Topological Polar Surface Area | 95.31 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 274.0082 |
| Monoisotopic Mass | 274.0082 |
| Heavy Atoms | 17 |
| Complexity | 639.19257 |
Chemical Identifiers
| CAS Number | 6882-74-2 |
|---|---|
| SMILES | CS(=O)(=O)N(C1=CC=CC=C1C#N)S(=O)(=O)C |
Product Overview
N-(2-cyanophenyl)-N-(methylsulfonyl)methanesulfonamide (CAS 6882-74-2), with molecular formula C9H10N2O4S2 and molecular weight 274.0082 g/mol. IUPAC: N-(2-cyanophenyl)-N-methylsulfonylmethanesulfonamide.