1,3-Bis(1,1-dimethylpropyl) dicarbonate
2-methylbutan-2-yl 2-methylbutan-2-yloxycarbonyl carbonate
Also Known As: Di-tert-amyl dicarbonate|Di-tert-pentyl dicarbonate|Di-tert-amyl pyrocarbonate|(Amoc)2O|di-t-amyl pyrocarbonate|Pyrocarbonicacidamylester|ACMC-1BIVN|Bis-tert-pentyl dicarbonate|DI-TERT-AMYLDICARBONATE|BIS(2-METHYLBUTAN-2-YL) DICARBONATE|Pyrocarbonic Acid Di-tert-amyl Ester|Di-tert-amyl dicarbonate, 97%|EINECS 272-436-1|2-methylbutan-2-yl 2-methylbutan-2-yloxycarbonyl Carbonate|Dicarbonic acid di(tert-pentyl) ester|Dicarbonic acid bis(tert-pentyl) ester|Dicarbonic acid, bis(1,1-dimethylpropyl) ester|1,3-Bis(1,1-dimethylpropyl) dicarbonate|BIS (2-METHYLBUTAN-2-YL) DICARBONATE|Dicarbonic acid bis(1,1-dimethylpropyl) ester|Dicarbonic acid di(1,1-dimethylpropyl) ester|S14-0870|1,1-dimethylpropoxycarbonyl 1,1-dimethylpropyl carbonate|4-CHLORO-5,6,7,8-TETRAHYDRO-2-(METHYLTHIO)PYRIDO[4,3-D]PYRIMIDINE
| Molecular Formula | C12H22O5 |
|---|---|
| Molecular Weight | 246.14673 g/mol |
| LogP | 3.6534 |
| Topological Polar Surface Area | 61.83 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 246.14673 |
| Monoisotopic Mass | 246.14673 |
| Heavy Atoms | 17 |
| Complexity | 252.62057 |
Chemical Identifiers
| CAS Number | 68835-89-2 |
|---|---|
| SMILES | CCC(C)(C)OC(=O)OC(=O)OC(C)(C)CC |
Product Overview
1,3-Bis(1,1-dimethylpropyl) dicarbonate (CAS 68835-89-2), with molecular formula C12H22O5 and molecular weight 246.14673 g/mol. IUPAC: 2-methylbutan-2-yl 2-methylbutan-2-yloxycarbonyl carbonate.