Maleic acid, dipotassium salt
dipotassium;(Z)-but-2-enedioate
Also Known As: POTASSIUM MALEATE|hydrogen maleate|Toxilic acid|Maleic acid, potassium salt|Maleic acid potassium|Maleic acid potassium salt|starbld0002290|Maleic acid dipotassium salt|dipotassium;(Z)-but-2-enedioate|maleic acid, dipotassium salt|Fumaric acid, potassium salt|dipotassium (Z)-but-2-enedioate|dipotassium,(Z)-but-2-enedioate|maleic acid,neutral potassium salt|Dipotassium (2Z)-but-2-enedioate|EINECS 233-569-0|TOXILIC ACID DIPOTASSIUM SALT|7135AF|2-Butenedioic acid (Z)-, potassium salt|2-Butenedioic acid (Z)-, dipotassium salt|2-Butenedioic acid, (Z)-, potassium salt|CIS-BUTENEDIOIC ACID DIPOTASSIUM SALT|3.5-Dihydroxy-6-allylmercapto-1.2.4-triazin|Maleic acid dipotassium salt, ~98% (titration)
| Molecular Formula | C4H2K2O4 |
|---|---|
| Molecular Weight | 191.92271 g/mol |
| LogP | -8.9496 |
| Topological Polar Surface Area | 80.26 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 191.92271 |
| Monoisotopic Mass | 191.92271 |
| Heavy Atoms | 10 |
| Complexity | 126.193016 |
Chemical Identifiers
| CAS Number | 689-82-7 |
|---|---|
| SMILES | C(=C\C(=O)[O-])\C(=O)[O-].[K+].[K+] |
Product Overview
Maleic acid, dipotassium salt (CAS 689-82-7), with molecular formula C4H2K2O4 and molecular weight 191.92271 g/mol. IUPAC: dipotassium;(Z)-but-2-enedioate.