Penicillin G sodium salt powder
sodium 3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
Also Known As: Penicillin G sodium|Penicillin|Benzylpenicillin|penicillin g|Penicillin G sodium salt|Sodium penicillin G|SODIUM|Benzylpenicillin sodium|Penicillin G sodium salt powder|BENZYLPENICILLIN SODIUM SALT|sodium;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate|sodium (2S,5R,6R)-3,3-dimethyl-7-oxo-6-(2-phenylacetamido)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate|sodium 3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
| Molecular Formula | C16H17N2NaO4S |
|---|---|
| Molecular Weight | 356.08066 g/mol |
| LogP | -3.4699 |
| Topological Polar Surface Area | 115.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 356.08066 |
| Monoisotopic Mass | 356.08066 |
| Heavy Atoms | 24 |
| Complexity | 536.0 |
Chemical Identifiers
| CAS Number | 69-57-8 |
|---|---|
| SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)[O-])C.[Na+] |
| InChIKey | FCPVYOBCFFNJFS-UHFFFAOYSA-M |
Product Overview
Penicillin G sodium salt powder (CAS 69-57-8), with molecular formula C16H17N2NaO4S and molecular weight 356.08066 g/mol. IUPAC: sodium 3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.