Diethyl L-malate
diethyl (2S)-2-hydroxybutanedioate
Also Known As: Diethyl L-malate|Diethyl L-(-)-Malate|L-Diethyl malate|(S)-Diethyl 2-hydroxysuccinate|Diethyl malate, L-|Diethyl-L-malate|Diethyl dl-malate|diethyl (S)-malate|DiethylL-(-)-Malate|(S)-malic acid diethyl ester|DIETHYL MALATE|L-(-)-Malic Acid Diethyl Ester|Diethyl (2S)-malate|diethyl (2S)-2-hydroxybutanedioate|Malic Acid Impurity 9|L-Malic acid diethyl ester|Diethyl (2S)-2-hydroxysuccinate|Diethyl (S)-(-)-2-hydroxysuccinate|Diethyl (S)-2-Hydroxysuccinate|(S)-Diethyl2-hydroxysuccinate|L-(-)-Apple Acid Diethyl Ester|(-)-L-Malic acid diethyl ester|L-Malic acid 1,4-diethyl ester|1,4-diethyl 2-hydroxybutanedioate|(S)-(-)-Diethyl hydroxysuccinate|KS-000017FK|(S)-2-Hydroxysuccinic acid diethyl|1,4-diethyl (2S)-2-hydroxybutanedioate|2-hydroxy-butanedioic acid diethyl ester|(2S)-2-Hydroxybutanedioic acid diethyl ester
| Molecular Formula | C8H14O5 |
|---|---|
| Molecular Weight | 190.08412 g/mol |
| LogP | -0.1364 |
| Topological Polar Surface Area | 72.83 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 190.08412 |
| Monoisotopic Mass | 190.08412 |
| Heavy Atoms | 13 |
| Complexity | 177.3732 |
Chemical Identifiers
| CAS Number | 691-84-9 |
|---|---|
| SMILES | CCOC(=O)C[C@@H](C(=O)OCC)O |
Product Overview
Diethyl L-malate (CAS 691-84-9), with molecular formula C8H14O5 and molecular weight 190.08412 g/mol. IUPAC: diethyl (2S)-2-hydroxybutanedioate.