![3-(2-Butylsulfanylethoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid structure](/static/products/6917/6917-45-9.webp)
3-(2-Butylsulfanylethoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid
3-(2-butylsulfanylethoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid
Also Known As: 3-(2-butylsulfanylethoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid|3-(2-butylsulfanylethoxycarbonyl)-7-oxabicyclo[2.2.1]heptane|3-{[2-(BUTYLSULFANYL)ETHOXY]CARBONYL}-7-OXABICYCLO[2.2.1]HEPTANE-2-CARBOXYLIC ACID
| Molecular Formula | C14H22O5S |
|---|---|
| Molecular Weight | 302.1188 g/mol |
| LogP | 1.8 |
| Topological Polar Surface Area | 98.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Exact Mass | 302.1188 |
| Monoisotopic Mass | 302.1188 |
| Heavy Atoms | 20 |
| Complexity | 359.0 |
Chemical Identifiers
| CAS Number | 6917-45-9 |
|---|---|
| SMILES | CCCCSCCOC(=O)C1C2CCC(C1C(=O)O)O2 |
| InChIKey | XBNKGOUYKZYJBP-UHFFFAOYSA-N |
Product Overview
3-(2-Butylsulfanylethoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 6917-45-9), with molecular formula C14H22O5S and molecular weight 302.1188 g/mol. IUPAC: 3-(2-butylsulfanylethoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
3-(2-Butylsulfanylethoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »