5-Bromo-2-methylbenzenesulphonyl chloride
5-bromo-2-methylbenzenesulfonyl chloride
Also Known As: 5-bromo-2-methylbenzenesulfonyl chloride|5-bromo-2-methylbenzene-1-sulfonyl chloride|zlchem 1049|5-bromo-2-methyl-benzenesulfonyl Chloride|ACMC-209o78|4-Bromo-2-(chlorosulphonyl)toluene|5-Bromo-2-methylbenzenesulphonyl chloride|ZLD0515|(5-bromo-2-methylphenyl)chlorosulfone|5-bromo-2-methylbenzenesulfonylchloride|Benzenesulfonyl chloride, 5-bromo-2-methyl-|5-Bromo-2-methylbenzene-1-sulfonylchloride|s10934|Benzenesulfonylchloride, 5-bromo-2-methyl-|1,5-DIMETHYL-1H-IMIDAZOLE-4-CARBALDEHYDE|321B568|I01-9147|816-696-1
| Molecular Formula | C7H6BrClO2S |
|---|---|
| Molecular Weight | 267.89603 g/mol |
| LogP | 2.68502 |
| Topological Polar Surface Area | 34.14 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 267.89603 |
| Monoisotopic Mass | 267.89603 |
| Heavy Atoms | 12 |
| Complexity | 399.86743 |
Chemical Identifiers
| CAS Number | 69321-56-8 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)Br)S(=O)(=O)Cl |
Product Overview
5-Bromo-2-methylbenzenesulphonyl chloride (CAS 69321-56-8), with molecular formula C7H6BrClO2S and molecular weight 267.89603 g/mol. IUPAC: 5-bromo-2-methylbenzenesulfonyl chloride.