N-[1-{[(2-furylmethyl)amino]carbonyl}-2-(2-thienyl)vinyl]-2-furamide
N-[(E)-3-(furan-2-ylmethylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]furan-2-carboxamide
Also Known As: N-[1-{[(2-furylmethyl)amino]carbonyl}-2-(2-thienyl)vinyl]-2-furamide|N-[(E)-3-(furan-2-ylmethylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]furan-2-carboxamide|(E)-N-(3-((furan-2-ylmethyl)amino)-3-oxo-1-(thiophen-2-yl)prop-1-en-2-yl)furan-2-carboxamide|N-[(1E)-3-[(furan-2-ylmethyl)amino]-3-oxo-1-(thiophen-2-yl)prop-1-en-2-yl]furan-2-carboxamide
| Molecular Formula | C17H14N2O4S |
|---|---|
| Molecular Weight | 342.0674 g/mol |
| LogP | 3.0214 |
| Topological Polar Surface Area | 84.48 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 342.0674 |
| Monoisotopic Mass | 342.0674 |
| Heavy Atoms | 24 |
| Complexity | 818.22345 |
Chemical Identifiers
| CAS Number | 693238-91-4 |
|---|---|
| SMILES | C1=COC(=C1)CNC(=O)/C(=C\C2=CC=CS2)/NC(=O)C3=CC=CO3 |
Product Overview
N-[1-{[(2-furylmethyl)amino]carbonyl}-2-(2-thienyl)vinyl]-2-furamide (CAS 693238-91-4), with molecular formula C17H14N2O4S and molecular weight 342.0674 g/mol. IUPAC: N-[(E)-3-(furan-2-ylmethylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]furan-2-carboxamide.
N-[1-{[(2-furylmethyl)amino]carbonyl}-2-(2-thienyl)vinyl]-2-furamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »